C18H15BrNO5- — CID 86607205
3-(4-bromo-2-phenylmethoxyanilino)-4-methoxy-4-oxobut-2-enoate (PubChem CID 86607205) has the molecular formula C18H15BrNO5- and a molecular weight of 405.22 g/mol. Its IUPAC name is 3-(4-bromo-2-phenylmethoxyanilino)-4-methoxy-4-oxobut-2-enoate.
| Compound Name | 3-(4-bromo-2-phenylmethoxyanilino)-4-methoxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 86607205 |
| Molecular Formula | C18H15BrNO5- |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 3-(4-bromo-2-phenylmethoxyanilino)-4-methoxy-4-oxobut-2-enoate |
| SMILES | COC(=O)C(=CC(=O)[O-])Nc1ccc(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C18H16BrNO5/c1-24-18(23)15(10-17(21)22)20-14-8-7-13(19)9-16(14)25-11-12-5-3-2-4-6-12/h2-10,20H,11H2,1H3,(H,21,22)/p-1 |
| InChIKey | WGTHSQIHIZHQJN-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|