C22H22ClN3O3 — CID 86609392
[4-chloro-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-6-yl] benzoate (PubChem CID 86609392) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is [4-chloro-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-6-yl] benzoate.
| Compound Name | [4-chloro-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-6-yl] benzoate |
|---|---|
| PubChem CID | 86609392 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [4-chloro-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-6-yl] benzoate |
| SMILES | CN1CCC(COc2cc3ncnc(Cl)c3cc2OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-26-9-7-15(8-10-26)13-28-19-12-18-17(21(23)25-14-24-18)11-20(19)29-22(27)16-5-3-2-4-6-16/h2-6,11-12,14-15H,7-10,13H2,1H3 |
| InChIKey | BWAJHHXMGSLRSP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|