C23H26BrN5O3S — CID 87714502
1-(2-bromophenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]sulfanylurea (PubChem CID 87714502) has the molecular formula C23H26BrN5O3S and a molecular weight of 532.46 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]sulfanylurea.
| Compound Name | 1-(2-bromophenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]sulfanylurea |
|---|---|
| PubChem CID | 87714502 |
| Molecular Formula | C23H26BrN5O3S |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 1-(2-bromophenyl)-3-[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]sulfanylurea |
| SMILES | COc1cc2c(SNC(=O)Nc3ccccc3Br)ncnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C23H26BrN5O3S/c1-29-9-7-15(8-10-29)13-32-21-12-19-16(11-20(21)31-2)22(26-14-25-19)33-28-23(30)27-18-6-4-3-5-17(18)24/h3-6,11-12,14-15H,7-10,13H2,1-2H3,(H2,27,28,30) |
| InChIKey | LNKIHZOTAFDWFP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|