C23H25BrN4O3 — CID 152679693
4-bromo-3-methoxy-N-[5-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]benzamide (PubChem CID 152679693) has the molecular formula C23H25BrN4O3 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-bromo-3-methoxy-N-[5-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]benzamide.
| Compound Name | 4-bromo-3-methoxy-N-[5-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]benzamide |
|---|---|
| PubChem CID | 152679693 |
| Molecular Formula | C23H25BrN4O3 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 4-bromo-3-methoxy-N-[5-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ncnc3cccc(OCC4CCN(C)CC4)c23)ccc1Br |
| InChI | InChI=1S/C23H25BrN4O3/c1-28-10-8-15(9-11-28)13-31-19-5-3-4-18-21(19)22(26-14-25-18)27-23(29)16-6-7-17(24)20(12-16)30-2/h3-7,12,14-15H,8-11,13H2,1-2H3,(H,25,26,27,29) |
| InChIKey | ZNGQVZUKWJYHPD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |