C24H28N4O5S — CID 87714807
1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-methoxyquinazolin-4-yl]sulfanyl-3-(2,6-dimethylphenyl)urea (PubChem CID 87714807) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is 1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-methoxyquinazolin-4-yl]sulfanyl-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-methoxyquinazolin-4-yl]sulfanyl-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 87714807 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-7-methoxyquinazolin-4-yl]sulfanyl-3-(2,6-dimethylphenyl)urea |
| SMILES | COc1cc2ncnc(SNC(=O)Nc3c(C)cccc3C)c2cc1OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C24H28N4O5S/c1-14-7-6-8-15(2)21(14)27-23(29)28-34-22-17-9-20(19(30-5)10-18(17)25-13-26-22)31-11-16-12-32-24(3,4)33-16/h6-10,13,16H,11-12H2,1-5H3,(H2,27,28,29) |
| InChIKey | CJKSXBGEJLFTCL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|