C23H21ClF3N3O4S — CID 86611501
2-[4-[2-amino-5-chloro-4-(trifluoromethyl)anilino]phenyl]ethyl N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 86611501) has the molecular formula C23H21ClF3N3O4S and a molecular weight of 527.95 g/mol. Its IUPAC name is 2-[4-[2-amino-5-chloro-4-(trifluoromethyl)anilino]phenyl]ethyl N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | 2-[4-[2-amino-5-chloro-4-(trifluoromethyl)anilino]phenyl]ethyl N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 86611501 |
| Molecular Formula | C23H21ClF3N3O4S |
| Molecular Weight | 527.95 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 2-[4-[2-amino-5-chloro-4-(trifluoromethyl)anilino]phenyl]ethyl N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)OCCc2ccc(Nc3cc(Cl)c(C(F)(F)F)cc3N)cc2)cc1 |
| InChI | InChI=1S/C23H21ClF3N3O4S/c1-14-2-8-17(9-3-14)35(32,33)30-22(31)34-11-10-15-4-6-16(7-5-15)29-21-13-19(24)18(12-20(21)28)23(25,26)27/h2-9,12-13,29H,10-11,28H2,1H3,(H,30,31) |
| InChIKey | KCQZAHWPNYEHIC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.95 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|