C7H5ClN2OS — CID 86611704
(6-chloro-[1,2]thiazolo[5,4-b]pyridin-3-yl)methanol (PubChem CID 86611704) has the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. Its IUPAC name is (6-chloro-[1,2]thiazolo[5,4-b]pyridin-3-yl)methanol.
| Compound Name | (6-chloro-[1,2]thiazolo[5,4-b]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 86611704 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (6-chloro-[1,2]thiazolo[5,4-b]pyridin-3-yl)methanol |
| SMILES | OCc1nsc2nc(Cl)ccc12 |
| InChI | InChI=1S/C7H5ClN2OS/c8-6-2-1-4-5(3-11)10-12-7(4)9-6/h1-2,11H,3H2 |
| InChIKey | WXFQPWSMKOHGPR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|