C23H20F6N2O6S — CID 86612038
ethyl 4-[(1S)-1-[3-[2-methoxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)pyrazol-1-yl]ethyl]benzoate (PubChem CID 86612038) has the molecular formula C23H20F6N2O6S and a molecular weight of 566.48 g/mol. Its IUPAC name is ethyl 4-[(1S)-1-[3-[2-methoxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)pyrazol-1-yl]ethyl]benzoate.
| Compound Name | ethyl 4-[(1S)-1-[3-[2-methoxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)pyrazol-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 86612038 |
| Molecular Formula | C23H20F6N2O6S |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | ethyl 4-[(1S)-1-[3-[2-methoxy-5-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)pyrazol-1-yl]ethyl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@H](C)n2nc(-c3cc(C(F)(F)F)ccc3OC)cc2OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F6N2O6S/c1-4-36-21(32)15-7-5-14(6-8-15)13(2)31-20(37-38(33,34)23(27,28)29)12-18(30-31)17-11-16(22(24,25)26)9-10-19(17)35-3/h5-13H,4H2,1-3H3/t13-/m0/s1 |
| InChIKey | IXTLVQALFFQWJX-ZDUSSCGKSA-N |
| XLogP | 5.59 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|