C21H24FN7 — CID 86613147
4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-N-[(1S)-1-(4-fluorophenyl)ethyl]-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 86613147) has the molecular formula C21H24FN7 and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-N-[(1S)-1-(4-fluorophenyl)ethyl]-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-N-[(1S)-1-(4-fluorophenyl)ethyl]-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86613147 |
| Molecular Formula | C21H24FN7 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-N-[(1S)-1-(4-fluorophenyl)ethyl]-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | C[C@H](Nc1nc2c(c(Nc3cc(C4CC4)[nH]n3)n1)CCCN2)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN7/c1-12(13-6-8-15(22)9-7-13)24-21-26-19-16(3-2-10-23-19)20(27-21)25-18-11-17(28-29-18)14-4-5-14/h6-9,11-12,14H,2-5,10H2,1H3,(H4,23,24,25,26,27,28,29)/t12-/m0/s1 |
| InChIKey | RVQNDXNZONAVMQ-LBPRGKRZSA-N |
| XLogP | 4.49 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |