About bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane
bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane (PubChem CID 86613232) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane |
| PubChem CID | 86613232 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane |
| SMILES | C1=CC2CCC1C2.COCC1CO1 |
| InChI | InChI=1S/C7H10.C4H8O2/c1-2-7-4-3-6(1)5-7;1-5-2-4-3-6-4/h1-2,6-7H,3-5H2;4H,2-3H2,1H3 |
| InChIKey | WWMXIWOJVFCAOO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane (CID 86613232) is bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane is C1=CC2CCC1C2.COCC1CO1.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane?
The InChIKey is WWMXIWOJVFCAOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C4H8O2/c1-2-7-4-3-6(1)5-7;1-5-2-4-3-6-4/h1-2,6-7H,3-5H2;4H,2-3H2,1H3.
What are the key properties of bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane?
bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane has a molecular weight of 182.26 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane is sourced from PubChem (CID 86613232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).