C22H36O2 — CID 86613231
bicyclo[2.2.1]hept-2-ene;1-butylbicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane (PubChem CID 86613231) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;1-butylbicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane.
| Compound Name | bicyclo[2.2.1]hept-2-ene;1-butylbicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane |
|---|---|
| PubChem CID | 86613231 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;1-butylbicyclo[2.2.1]hept-2-ene;2-(methoxymethyl)oxirane |
| SMILES | C1=CC2CCC1C2.CCCCC12C=CC(CC1)C2.COCC1CO1 |
| InChI | InChI=1S/C11H18.C7H10.C4H8O2/c1-2-3-6-11-7-4-10(9-11)5-8-11;1-2-7-4-3-6(1)5-7;1-5-2-4-3-6-4/h4,7,10H,2-3,5-6,8-9H2,1H3;1-2,6-7H,3-5H2;4H,2-3H2,1H3 |
| InChIKey | OCWOLIKVYAPVPE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|