About tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate
tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate (PubChem CID 86614510) has the molecular formula C14H17NO3S
and a molecular weight of 279.36 g/mol. Its IUPAC name is tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate |
| PubChem CID | 86614510 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=S)COc2ccccc21 |
| InChI | InChI=1S/C14H17NO3S/c1-14(2,3)18-13(16)8-15-10-6-4-5-7-11(10)17-9-12(15)19/h4-7H,8-9H2,1-3H3 |
| InChIKey | OXYXTXOFIDUWLN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate?
The IUPAC name of tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate (CID 86614510) is tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate.
What is the SMILES notation for tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate?
The canonical SMILES for tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate is CC(C)(C)OC(=O)CN1C(=S)COc2ccccc21.
What is the InChIKey of tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate?
The InChIKey is OXYXTXOFIDUWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S/c1-14(2,3)18-13(16)8-15-10-6-4-5-7-11(10)17-9-12(15)19/h4-7H,8-9H2,1-3H3.
What are the key properties of tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate?
tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate has a molecular weight of 279.36 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3-sulfanylidene-1,4-benzoxazin-4-yl)acetate is sourced from PubChem (CID 86614510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).