C23H29ClN2O4 — CID 86615985
methyl 3-[[4-[1-[(6-chloro-3-pyridinyl)oxy]-4,4-dimethylpentyl]benzoyl]amino]propanoate (PubChem CID 86615985) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is methyl 3-[[4-[1-[(6-chloro-3-pyridinyl)oxy]-4,4-dimethylpentyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[1-[(6-chloro-3-pyridinyl)oxy]-4,4-dimethylpentyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 86615985 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl 3-[[4-[1-[(6-chloro-3-pyridinyl)oxy]-4,4-dimethylpentyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(C(CCC(C)(C)C)Oc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C23H29ClN2O4/c1-23(2,3)13-11-19(30-18-9-10-20(24)26-15-18)16-5-7-17(8-6-16)22(28)25-14-12-21(27)29-4/h5-10,15,19H,11-14H2,1-4H3,(H,25,28) |
| InChIKey | ADRPZFZOXMXHNC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|