C18H25ClN8O — CID 86616764
(3R)-1-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)pyrrolidin-3-ol (PubChem CID 86616764) has the molecular formula C18H25ClN8O and a molecular weight of 404.91 g/mol. Its IUPAC name is (3R)-1-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 86616764 |
| Molecular Formula | C18H25ClN8O |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (3R)-1-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(c2nc3nc(N4CCNCC4)nc(N4CCCC4)c3nc2Cl)C1 |
| InChI | InChI=1S/C18H25ClN8O/c19-14-17(27-8-3-12(28)11-27)22-15-13(21-14)16(25-6-1-2-7-25)24-18(23-15)26-9-4-20-5-10-26/h12,20,28H,1-11H2/t12-/m1/s1 |
| InChIKey | UPYUHOJMHBVEKX-GFCCVEGCSA-N |
| XLogP | 0.65 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |