C19H27ClN8O2 — CID 87510030
[4-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)morpholin-3-yl]methanol (PubChem CID 87510030) has the molecular formula C19H27ClN8O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is [4-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)morpholin-3-yl]methanol.
| Compound Name | [4-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 87510030 |
| Molecular Formula | C19H27ClN8O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [4-(6-chloro-2-piperazin-1-yl-4-pyrrolidin-1-ylpteridin-7-yl)morpholin-3-yl]methanol |
| SMILES | OCC1COCCN1c1nc2nc(N3CCNCC3)nc(N3CCCC3)c2nc1Cl |
| InChI | InChI=1S/C19H27ClN8O2/c20-15-18(28-9-10-30-12-13(28)11-29)23-16-14(22-15)17(26-5-1-2-6-26)25-19(24-16)27-7-3-21-4-8-27/h13,21,29H,1-12H2 |
| InChIKey | BMYFNHBFUQBANR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |