C18H15Br3N2O4 — CID 86617376
ethyl 2,3,7-tribromo-4-hydroxy-1-[(3-methoxyphenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylate (PubChem CID 86617376) has the molecular formula C18H15Br3N2O4 and a molecular weight of 563.04 g/mol. Its IUPAC name is ethyl 2,3,7-tribromo-4-hydroxy-1-[(3-methoxyphenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylate.
| Compound Name | ethyl 2,3,7-tribromo-4-hydroxy-1-[(3-methoxyphenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 86617376 |
| Molecular Formula | C18H15Br3N2O4 |
| Molecular Weight | 563.04 g/mol |
| Exact Mass | 559.86 |
| IUPAC Name | ethyl 2,3,7-tribromo-4-hydroxy-1-[(3-methoxyphenyl)methyl]pyrrolo[2,3-c]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1nc(Br)c2c(c1O)c(Br)c(Br)n2Cc1cccc(OC)c1 |
| InChI | InChI=1S/C18H15Br3N2O4/c1-3-27-18(25)13-15(24)11-12(19)17(21)23(14(11)16(20)22-13)8-9-5-4-6-10(7-9)26-2/h4-7,24H,3,8H2,1-2H3 |
| InChIKey | ONZFLXOHEASXIV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|