C24H24N2O6 — CID 138980444
diethyl 2-[(3-methoxyphenyl)methyl]-10-methyl-3-oxo-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-5,6-dicarboxylate (PubChem CID 138980444) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is diethyl 2-[(3-methoxyphenyl)methyl]-10-methyl-3-oxo-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-5,6-dicarboxylate.
| Compound Name | diethyl 2-[(3-methoxyphenyl)methyl]-10-methyl-3-oxo-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 138980444 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | diethyl 2-[(3-methoxyphenyl)methyl]-10-methyl-3-oxo-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),4,6,8-tetraene-5,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2c(=O)n(Cc3cccc(OC)c3)c3c(C)ccc1n23 |
| InChI | InChI=1S/C24H24N2O6/c1-5-31-23(28)18-17-11-10-14(3)21-25(13-15-8-7-9-16(12-15)30-4)22(27)20(26(17)21)19(18)24(29)32-6-2/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | ZDMKKHNNMJAIER-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |