C15H10F3N5O3 — CID 8661896
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 8661896) has the molecular formula C15H10F3N5O3 and a molecular weight of 365.27 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 8661896 |
| Molecular Formula | C15H10F3N5O3 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1ccnc2nc(C(=O)OCC(=O)Nc3ccc(F)c(F)c3F)nn12 |
| InChI | InChI=1S/C15H10F3N5O3/c1-7-4-5-19-15-21-13(22-23(7)15)14(25)26-6-10(24)20-9-3-2-8(16)11(17)12(9)18/h2-5H,6H2,1H3,(H,20,24) |
| InChIKey | NLTSZSJOZVKMBZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|