C19H20N6O4 — CID 7953816
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 7953816) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 7953816 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1ccnc2nc(C(=O)OCC(=O)Nc3ccc(N4CCOCC4)cc3)nn12 |
| InChI | InChI=1S/C19H20N6O4/c1-13-6-7-20-19-22-17(23-25(13)19)18(27)29-12-16(26)21-14-2-4-15(5-3-14)24-8-10-28-11-9-24/h2-7H,8-12H2,1H3,(H,21,26) |
| InChIKey | YANRABAVHJALBI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|