C25H36F2N4O3S — CID 86620137
tert-butyl N-[(6S,9R)-3-[1-(tert-butylsulfinylamino)ethyl]-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-9-yl]carbamate (PubChem CID 86620137) has the molecular formula C25H36F2N4O3S and a molecular weight of 510.65 g/mol. Its IUPAC name is tert-butyl N-[(6S,9R)-3-[1-(tert-butylsulfinylamino)ethyl]-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-9-yl]carbamate.
| Compound Name | tert-butyl N-[(6S,9R)-3-[1-(tert-butylsulfinylamino)ethyl]-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-9-yl]carbamate |
|---|---|
| PubChem CID | 86620137 |
| Molecular Formula | C25H36F2N4O3S |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | tert-butyl N-[(6S,9R)-3-[1-(tert-butylsulfinylamino)ethyl]-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-9-yl]carbamate |
| SMILES | CC(NS(=O)C(C)(C)C)c1cnc2n1C[C@H](c1cccc(F)c1F)CC[C@H]2NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36F2N4O3S/c1-15(30-35(33)25(5,6)7)20-13-28-22-19(29-23(32)34-24(2,3)4)12-11-16(14-31(20)22)17-9-8-10-18(26)21(17)27/h8-10,13,15-16,19,30H,11-12,14H2,1-7H3,(H,29,32)/t15?,16-,19-,35?/m1/s1 |
| InChIKey | WEMABLVUUPHOPJ-LXWKWQKPSA-N |
| XLogP | 5.42 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |