C13H20F3NO3 — CID 86622316
methyl (2S)-2-[methyl(5,5,5-trifluoropentanoyl)amino]hex-5-enoate (PubChem CID 86622316) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl (2S)-2-[methyl(5,5,5-trifluoropentanoyl)amino]hex-5-enoate.
| Compound Name | methyl (2S)-2-[methyl(5,5,5-trifluoropentanoyl)amino]hex-5-enoate |
|---|---|
| PubChem CID | 86622316 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl (2S)-2-[methyl(5,5,5-trifluoropentanoyl)amino]hex-5-enoate |
| SMILES | C=CCC[C@@H](C(=O)OC)N(C)C(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c1-4-5-7-10(12(19)20-3)17(2)11(18)8-6-9-13(14,15)16/h4,10H,1,5-9H2,2-3H3/t10-/m0/s1 |
| InChIKey | QUEZOFQFRZSZFN-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|