C10H19F3N2O — CID 82851778
5-amino-N-methyl-N-(3,3,3-trifluoropropyl)hexanamide (PubChem CID 82851778) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 5-amino-N-methyl-N-(3,3,3-trifluoropropyl)hexanamide.
| Compound Name | 5-amino-N-methyl-N-(3,3,3-trifluoropropyl)hexanamide |
|---|---|
| PubChem CID | 82851778 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-amino-N-methyl-N-(3,3,3-trifluoropropyl)hexanamide |
| SMILES | CC(N)CCCC(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-8(14)4-3-5-9(16)15(2)7-6-10(11,12)13/h8H,3-7,14H2,1-2H3 |
| InChIKey | XLRKTHROLARHLP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |