C28H40N2O5 — CID 86622322
tert-butyl N-[(2S,3R)-3-hydroxy-4-[[1-(3-methoxyphenyl)-3-prop-2-enoxypropyl]amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 86622322) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-[[1-(3-methoxyphenyl)-3-prop-2-enoxypropyl]amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[[1-(3-methoxyphenyl)-3-prop-2-enoxypropyl]amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86622322 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[[1-(3-methoxyphenyl)-3-prop-2-enoxypropyl]amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | C=CCOCCC(NC[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)c1cccc(OC)c1 |
| InChI | InChI=1S/C28H40N2O5/c1-6-16-34-17-15-24(22-13-10-14-23(19-22)33-5)29-20-26(31)25(18-21-11-8-7-9-12-21)30-27(32)35-28(2,3)4/h6-14,19,24-26,29,31H,1,15-18,20H2,2-5H3,(H,30,32)/t24?,25-,26+/m0/s1 |
| InChIKey | QEGRGUGJOTWMEV-XBCLTQTASA-N |
| XLogP | 4.42 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|