C10H18N3O3S2- — CID 86623290
2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonate (PubChem CID 86623290) has the molecular formula C10H18N3O3S2- and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonate.
| Compound Name | 2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonate |
|---|---|
| PubChem CID | 86623290 |
| Molecular Formula | C10H18N3O3S2- |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-amino-6-(propylamino)-4,5,6,7-tetrahydro-3H-1,3-benzothiazole-2-sulfonate |
| SMILES | CCCNC1CCC2=C(C1)SC(N)(S(=O)(=O)[O-])N2 |
| InChI | InChI=1S/C10H19N3O3S2/c1-2-5-12-7-3-4-8-9(6-7)17-10(11,13-8)18(14,15)16/h7,12-13H,2-6,11H2,1H3,(H,14,15,16)/p-1 |
| InChIKey | ZVFFKSTVBHXVKY-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|