C13H20BrN3O3 — CID 86627859
2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide bromide (PubChem CID 86627859) has the molecular formula C13H20BrN3O3 and a molecular weight of 346.23 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide bromide.
| Compound Name | 2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide bromide |
|---|---|
| PubChem CID | 86627859 |
| Molecular Formula | C13H20BrN3O3 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-[(3R)-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide bromide |
| SMILES | Cc1cc(NC(=O)C[N+]23CCC(CC2)[C@@H](O)C3)no1.[Br-] |
| InChI | InChI=1S/C13H19N3O3.BrH/c1-9-6-12(15-19-9)14-13(18)8-16-4-2-10(3-5-16)11(17)7-16;/h6,10-11,17H,2-5,7-8H2,1H3;1H/t10?,11-,16?;/m0./s1 |
| InChIKey | DVGIZZXKCREFIG-AKXISVSUSA-N |
| XLogP | -2.47 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|