About ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide
ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide (PubChem CID 86630324) has the molecular formula C23H48BrNO2
and a molecular weight of 450.55 g/mol. Its IUPAC name is ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide.
Molecular Properties
| Compound Name | ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide |
| PubChem CID | 86630324 |
| Molecular Formula | C23H48BrNO2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide |
| SMILES | C=CC(=O)OCC.CCCCCCCCCCCCCCCC[NH+](C)C.[Br-] |
| InChI | InChI=1S/C18H39N.C5H8O2.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;1-3-5(6)7-4-2;/h4-18H2,1-3H3;3H,1,4H2,2H3;1H |
| InChIKey | CELQFNZYOXEHBK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide?
The IUPAC name of ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide (CID 86630324) is ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide.
What is the SMILES notation for ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide?
The canonical SMILES for ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide is C=CC(=O)OCC.CCCCCCCCCCCCCCCC[NH+](C)C.[Br-].
What is the InChIKey of ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide?
The InChIKey is CELQFNZYOXEHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N.C5H8O2.BrH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;1-3-5(6)7-4-2;/h4-18H2,1-3H3;3H,1,4H2,2H3;1H.
What are the key properties of ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide?
ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide has a molecular weight of 450.55 g/mol, XLogP of 2.35, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enoate;hexadecyl(dimethyl)azanium;bromide is sourced from PubChem (CID 86630324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).