C36H38N4O9 — CID 86630722
N-[1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 86630722) has the molecular formula C36H38N4O9 and a molecular weight of 670.72 g/mol. Its IUPAC name is N-[1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 86630722 |
| Molecular Formula | C36H38N4O9 |
| Molecular Weight | 670.72 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | N-[1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(2-cyanoethoxymethoxy)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(NC(C)=O)nc3=O)[C@H](OCOCCC#N)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H38N4O9/c1-24(41)38-31-18-20-40(35(43)39-31)34-33(47-23-46-21-7-19-37)32(42)30(49-34)22-48-36(25-8-5-4-6-9-25,26-10-14-28(44-2)15-11-26)27-12-16-29(45-3)17-13-27/h4-6,8-18,20,30,32-34,42H,7,21-23H2,1-3H3,(H,38,39,41,43)/t30-,32-,33-,34-/m1/s1 |
| InChIKey | AAVRBLKQUFUEJS-DWNQJFHRSA-N |
| XLogP | 3.76 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.72 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|