C26H25N5O4S — CID 86631985
ethyl N-[[5-[3-[[3-(2-cyanopropan-2-yl)benzoyl]amino]phenoxy]-2-pyridinyl]carbamothioyl]carbamate (PubChem CID 86631985) has the molecular formula C26H25N5O4S and a molecular weight of 503.58 g/mol. Its IUPAC name is ethyl N-[[5-[3-[[3-(2-cyanopropan-2-yl)benzoyl]amino]phenoxy]-2-pyridinyl]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[5-[3-[[3-(2-cyanopropan-2-yl)benzoyl]amino]phenoxy]-2-pyridinyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 86631985 |
| Molecular Formula | C26H25N5O4S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | ethyl N-[[5-[3-[[3-(2-cyanopropan-2-yl)benzoyl]amino]phenoxy]-2-pyridinyl]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1ccc(Oc2cccc(NC(=O)c3cccc(C(C)(C)C#N)c3)c2)cn1 |
| InChI | InChI=1S/C26H25N5O4S/c1-4-34-25(33)31-24(36)30-22-12-11-21(15-28-22)35-20-10-6-9-19(14-20)29-23(32)17-7-5-8-18(13-17)26(2,3)16-27/h5-15H,4H2,1-3H3,(H,29,32)(H2,28,30,31,33,36) |
| InChIKey | MHCPIFWSGHONPE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|