C21H15N5O2 — CID 86634457
2-(azidomethyl)-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid (PubChem CID 86634457) has the molecular formula C21H15N5O2 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(azidomethyl)-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid.
| Compound Name | 2-(azidomethyl)-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 86634457 |
| Molecular Formula | C21H15N5O2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(azidomethyl)-4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
| SMILES | [N-]=[N+]=NCc1cc(-c2c[nH]c3ncc(-c4ccccc4)cc23)ccc1C(=O)O |
| InChI | InChI=1S/C21H15N5O2/c22-26-25-11-16-8-14(6-7-17(16)21(27)28)19-12-24-20-18(19)9-15(10-23-20)13-4-2-1-3-5-13/h1-10,12H,11H2,(H,23,24)(H,27,28) |
| InChIKey | YJHAYOHXCZPCQG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|