C21H31BrN3O3Si- — CID 86634592
N-[1-[[5-bromo-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazol-3-yl]-N-(2-trimethylsilylethyl)carbamate (PubChem CID 86634592) has the molecular formula C21H31BrN3O3Si- and a molecular weight of 481.49 g/mol. Its IUPAC name is N-[1-[[5-bromo-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazol-3-yl]-N-(2-trimethylsilylethyl)carbamate.
| Compound Name | N-[1-[[5-bromo-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazol-3-yl]-N-(2-trimethylsilylethyl)carbamate |
|---|---|
| PubChem CID | 86634592 |
| Molecular Formula | C21H31BrN3O3Si- |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[1-[[5-bromo-2-(2-methylpropoxy)phenyl]methyl]-5-methylpyrazol-3-yl]-N-(2-trimethylsilylethyl)carbamate |
| SMILES | Cc1cc(N(CC[Si](C)(C)C)C(=O)[O-])nn1Cc1cc(Br)ccc1OCC(C)C |
| InChI | InChI=1S/C21H32BrN3O3Si/c1-15(2)14-28-19-8-7-18(22)12-17(19)13-25-16(3)11-20(23-25)24(21(26)27)9-10-29(4,5)6/h7-8,11-12,15H,9-10,13-14H2,1-6H3,(H,26,27)/p-1 |
| InChIKey | JRZXOWRGSYMKFG-UHFFFAOYSA-M |
| XLogP | 4.53 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|