C20H29NO2 — CID 86634680
4-ethoxy-4-(3-methoxyprop-1-ynyl)-N,N-dimethyl-1-phenylcyclohexan-1-amine (PubChem CID 86634680) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-ethoxy-4-(3-methoxyprop-1-ynyl)-N,N-dimethyl-1-phenylcyclohexan-1-amine.
| Compound Name | 4-ethoxy-4-(3-methoxyprop-1-ynyl)-N,N-dimethyl-1-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 86634680 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 4-ethoxy-4-(3-methoxyprop-1-ynyl)-N,N-dimethyl-1-phenylcyclohexan-1-amine |
| SMILES | CCOC1(C#CCOC)CCC(c2ccccc2)(N(C)C)CC1 |
| InChI | InChI=1S/C20H29NO2/c1-5-23-19(12-9-17-22-4)13-15-20(16-14-19,21(2)3)18-10-7-6-8-11-18/h6-8,10-11H,5,13-17H2,1-4H3 |
| InChIKey | ZZWVQDBIUWZEEL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|