C24H39NO8S — CID 158207775
ethyl 3-[4-(dimethylamino)-1-(3-ethoxy-3-oxopropyl)-4-phenylcyclohexyl]propanoate;sulfuric acid (PubChem CID 158207775) has the molecular formula C24H39NO8S and a molecular weight of 501.64 g/mol. Its IUPAC name is ethyl 3-[4-(dimethylamino)-1-(3-ethoxy-3-oxopropyl)-4-phenylcyclohexyl]propanoate;sulfuric acid.
| Compound Name | ethyl 3-[4-(dimethylamino)-1-(3-ethoxy-3-oxopropyl)-4-phenylcyclohexyl]propanoate;sulfuric acid |
|---|---|
| PubChem CID | 158207775 |
| Molecular Formula | C24H39NO8S |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | ethyl 3-[4-(dimethylamino)-1-(3-ethoxy-3-oxopropyl)-4-phenylcyclohexyl]propanoate;sulfuric acid |
| SMILES | CCOC(=O)CCC1(CCC(=O)OCC)CCC(c2ccccc2)(N(C)C)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C24H37NO4.H2O4S/c1-5-28-21(26)12-14-23(15-13-22(27)29-6-2)16-18-24(19-17-23,25(3)4)20-10-8-7-9-11-20;1-5(2,3)4/h7-11H,5-6,12-19H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | GBRWICAENJWULW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|