C29H43NO2 — CID 91125918
4-(1-ethoxyethoxymethyl)-N,N-dimethyl-1-phenyl-4-(4-phenylbutyl)cyclohexan-1-amine (PubChem CID 91125918) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is 4-(1-ethoxyethoxymethyl)-N,N-dimethyl-1-phenyl-4-(4-phenylbutyl)cyclohexan-1-amine.
| Compound Name | 4-(1-ethoxyethoxymethyl)-N,N-dimethyl-1-phenyl-4-(4-phenylbutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 91125918 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | 4-(1-ethoxyethoxymethyl)-N,N-dimethyl-1-phenyl-4-(4-phenylbutyl)cyclohexan-1-amine |
| SMILES | CCOC(C)OCC1(CCCCc2ccccc2)CCC(c2ccccc2)(N(C)C)CC1 |
| InChI | InChI=1S/C29H43NO2/c1-5-31-25(2)32-24-28(19-13-12-16-26-14-8-6-9-15-26)20-22-29(23-21-28,30(3)4)27-17-10-7-11-18-27/h6-11,14-15,17-18,25H,5,12-13,16,19-24H2,1-4H3 |
| InChIKey | HTWIRSFCDKLBOP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|