C19H30N2O2S — CID 86635957
tert-butyl 2-[amino-(3-ethylsulfanylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 86635957) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is tert-butyl 2-[amino-(3-ethylsulfanylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[amino-(3-ethylsulfanylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86635957 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl 2-[amino-(3-ethylsulfanylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | CCSc1cccc(C(N)C2CCCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H30N2O2S/c1-5-24-15-10-8-9-14(13-15)17(20)16-11-6-7-12-21(16)18(22)23-19(2,3)4/h8-10,13,16-17H,5-7,11-12,20H2,1-4H3 |
| InChIKey | RDDLLSBJZXHBJP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |