C18H13F6NO — CID 86636105
[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]methanol (PubChem CID 86636105) has the molecular formula C18H13F6NO and a molecular weight of 373.30 g/mol. Its IUPAC name is [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]methanol.
| Compound Name | [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]methanol |
|---|---|
| PubChem CID | 86636105 |
| Molecular Formula | C18H13F6NO |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [1-[[3,5-bis(trifluoromethyl)phenyl]methyl]indol-3-yl]methanol |
| SMILES | OCc1cn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C18H13F6NO/c19-17(20,21)13-5-11(6-14(7-13)18(22,23)24)8-25-9-12(10-26)15-3-1-2-4-16(15)25/h1-7,9,26H,8,10H2 |
| InChIKey | HUNUNISKFMIHMU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |