C26H39N3O8S — CID 86637064
3-O,9-O-ditert-butyl 6-O-ethyl 7-[2-(2-hydroxyethoxymethyl)-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate (PubChem CID 86637064) has the molecular formula C26H39N3O8S and a molecular weight of 553.68 g/mol. Its IUPAC name is 3-O,9-O-ditert-butyl 6-O-ethyl 7-[2-(2-hydroxyethoxymethyl)-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate.
| Compound Name | 3-O,9-O-ditert-butyl 6-O-ethyl 7-[2-(2-hydroxyethoxymethyl)-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate |
|---|---|
| PubChem CID | 86637064 |
| Molecular Formula | C26H39N3O8S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 3-O,9-O-ditert-butyl 6-O-ethyl 7-[2-(2-hydroxyethoxymethyl)-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate |
| SMILES | CCOC(=O)C1=C(c2cnc(COCCO)s2)CC2CN(C(=O)OC(C)(C)C)CC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H39N3O8S/c1-8-35-22(31)21-17(19-12-27-20(38-19)15-34-10-9-30)11-16-13-28(23(32)36-25(2,3)4)14-18(21)29(16)24(33)37-26(5,6)7/h12,16,18,30H,8-11,13-15H2,1-7H3 |
| InChIKey | MBZCBTFSUCFHIH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 127.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|