C30H49N3O8SSi — CID 86637075
3-O,9-O-ditert-butyl 6-O-methyl 7-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate (PubChem CID 86637075) has the molecular formula C30H49N3O8SSi and a molecular weight of 639.89 g/mol. Its IUPAC name is 3-O,9-O-ditert-butyl 6-O-methyl 7-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate.
| Compound Name | 3-O,9-O-ditert-butyl 6-O-methyl 7-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate |
|---|---|
| PubChem CID | 86637075 |
| Molecular Formula | C30H49N3O8SSi |
| Molecular Weight | 639.89 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | 3-O,9-O-ditert-butyl 6-O-methyl 7-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-1,3-thiazol-5-yl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate |
| SMILES | COC(=O)C1=C(c2cnc(OCCO[Si](C)(C)C(C)(C)C)s2)CC2CN(C(=O)OC(C)(C)C)CC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H49N3O8SSi/c1-28(2,3)40-26(35)32-17-19-15-20(22-16-31-25(42-22)38-13-14-39-43(11,12)30(7,8)9)23(24(34)37-10)21(18-32)33(19)27(36)41-29(4,5)6/h16,19,21H,13-15,17-18H2,1-12H3 |
| InChIKey | NHCRAOZXVKFKSJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 116.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.89 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|