C36H52N2O5Si — CID 77288998
6-O-benzyl 3-O-tert-butyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-3,6-dicarboxylate (PubChem CID 77288998) has the molecular formula C36H52N2O5Si and a molecular weight of 620.91 g/mol. Its IUPAC name is 6-O-benzyl 3-O-tert-butyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-3,6-dicarboxylate.
| Compound Name | 6-O-benzyl 3-O-tert-butyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-3,6-dicarboxylate |
|---|---|
| PubChem CID | 77288998 |
| Molecular Formula | C36H52N2O5Si |
| Molecular Weight | 620.91 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 6-O-benzyl 3-O-tert-butyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-3,6-dicarboxylate |
| SMILES | CN1C2CC(c3ccc(CCCO[Si](C)(C)C(C)(C)C)cc3)=C(C(=O)OCc3ccccc3)C1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C36H52N2O5Si/c1-35(2,3)43-34(40)38-23-29-22-30(28-19-17-26(18-20-28)16-13-21-42-44(8,9)36(4,5)6)32(31(24-38)37(29)7)33(39)41-25-27-14-11-10-12-15-27/h10-12,14-15,17-20,29,31H,13,16,21-25H2,1-9H3 |
| InChIKey | WFXSACANZVHEEY-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.91 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|