C27H43NO5Si — CID 68506146
1-O-tert-butyl 5-O-methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 68506146) has the molecular formula C27H43NO5Si and a molecular weight of 489.73 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 68506146 |
| Molecular Formula | C27H43NO5Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 4-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=C(c2ccc(CCCO[Si](C)(C)C(C)(C)C)cc2)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H43NO5Si/c1-26(2,3)33-25(30)28-17-16-22(23(19-28)24(29)31-7)21-14-12-20(13-15-21)11-10-18-32-34(8,9)27(4,5)6/h12-15H,10-11,16-19H2,1-9H3 |
| InChIKey | DVDHJDMVRBZRME-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|