C29H32ClF2NO5 — CID 69246318
5-O-tert-butyl 7-O-methyl 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-5-azaspiro[2.5]oct-7-ene-5,7-dicarboxylate (PubChem CID 69246318) has the molecular formula C29H32ClF2NO5 and a molecular weight of 548.03 g/mol. Its IUPAC name is 5-O-tert-butyl 7-O-methyl 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-5-azaspiro[2.5]oct-7-ene-5,7-dicarboxylate.
| Compound Name | 5-O-tert-butyl 7-O-methyl 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-5-azaspiro[2.5]oct-7-ene-5,7-dicarboxylate |
|---|---|
| PubChem CID | 69246318 |
| Molecular Formula | C29H32ClF2NO5 |
| Molecular Weight | 548.03 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 5-O-tert-butyl 7-O-methyl 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-5-azaspiro[2.5]oct-7-ene-5,7-dicarboxylate |
| SMILES | COC(=O)C1=C(c2ccc(CCCOc3c(F)ccc(F)c3Cl)cc2)C2(CC2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C29H32ClF2NO5/c1-28(2,3)38-27(35)33-16-20(26(34)36-4)23(29(17-33)13-14-29)19-9-7-18(8-10-19)6-5-15-37-25-22(32)12-11-21(31)24(25)30/h7-12H,5-6,13-17H2,1-4H3 |
| InChIKey | ANRYCCQXAIGRKF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.03 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|