C29H32ClF2NO6 — CID 86609177
9-O-tert-butyl 6-O-methyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-6,9-dicarboxylate (PubChem CID 86609177) has the molecular formula C29H32ClF2NO6 and a molecular weight of 564.03 g/mol. Its IUPAC name is 9-O-tert-butyl 6-O-methyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-6,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 6-O-methyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-6,9-dicarboxylate |
|---|---|
| PubChem CID | 86609177 |
| Molecular Formula | C29H32ClF2NO6 |
| Molecular Weight | 564.03 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 9-O-tert-butyl 6-O-methyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-6,9-dicarboxylate |
| SMILES | COC(=O)C1=C(c2ccc(CCCOc3c(F)ccc(F)c3Cl)cc2)CC2COCC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H32ClF2NO6/c1-29(2,3)39-28(35)33-19-14-20(24(27(34)36-4)23(33)16-37-15-19)18-9-7-17(8-10-18)6-5-13-38-26-22(32)12-11-21(31)25(26)30/h7-12,19,23H,5-6,13-16H2,1-4H3 |
| InChIKey | QQWTXNBGOQXHCW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.03 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|