C27H31ClF2N2O8S — CID 70309932
2-[2-(dihydroxyamino)oxyethoxy]ethyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxo-3λ4-thia-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 70309932) has the molecular formula C27H31ClF2N2O8S and a molecular weight of 617.07 g/mol. Its IUPAC name is 2-[2-(dihydroxyamino)oxyethoxy]ethyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxo-3λ4-thia-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxo-3λ4-thia-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 70309932 |
| Molecular Formula | C27H31ClF2N2O8S |
| Molecular Weight | 617.07 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl 7-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-3-oxo-3λ4-thia-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | O=C(OCCOCCON(O)O)N1C2C=C(c3ccc(CCCOc4c(F)ccc(F)c4Cl)cc3)CC1CS(=O)C2 |
| InChI | InChI=1S/C27H31ClF2N2O8S/c28-25-23(29)7-8-24(30)26(25)38-9-1-2-18-3-5-19(6-4-18)20-14-21-16-41(36)17-22(15-20)31(21)27(33)39-12-10-37-11-13-40-32(34)35/h3-8,14,21-22,34-35H,1-2,9-13,15-17H2 |
| InChIKey | KLGLQTGBHGDTFZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.07 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|