C30H43N2O3PSi — CID 71065207
benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-phosphanyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate (PubChem CID 71065207) has the molecular formula C30H43N2O3PSi and a molecular weight of 538.75 g/mol. Its IUPAC name is benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-phosphanyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate.
| Compound Name | benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-phosphanyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 71065207 |
| Molecular Formula | C30H43N2O3PSi |
| Molecular Weight | 538.75 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-phosphanyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCc1ccc(C2=C(C(=O)OCc3ccccc3)C3CNCC(C2)N3P)cc1 |
| InChI | InChI=1S/C30H43N2O3PSi/c1-30(2,3)37(4,5)35-17-9-12-22-13-15-24(16-14-22)26-18-25-19-31-20-27(32(25)36)28(26)29(33)34-21-23-10-7-6-8-11-23/h6-8,10-11,13-16,25,27,31H,9,12,17-21,36H2,1-5H3 |
| InChIKey | RXAHLGBNWVWINF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|