C42H49Cl3N2O7 — CID 142670360
6-O-benzyl 3-O-tert-butyl 9-O-(1,1,1-trichloro-2-methylpropan-2-yl) 7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate (PubChem CID 142670360) has the molecular formula C42H49Cl3N2O7 and a molecular weight of 800.22 g/mol. Its IUPAC name is 6-O-benzyl 3-O-tert-butyl 9-O-(1,1,1-trichloro-2-methylpropan-2-yl) 7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate.
| Compound Name | 6-O-benzyl 3-O-tert-butyl 9-O-(1,1,1-trichloro-2-methylpropan-2-yl) 7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate |
|---|---|
| PubChem CID | 142670360 |
| Molecular Formula | C42H49Cl3N2O7 |
| Molecular Weight | 800.22 g/mol |
| Exact Mass | 798.26 |
| IUPAC Name | 6-O-benzyl 3-O-tert-butyl 9-O-(1,1,1-trichloro-2-methylpropan-2-yl) 7-[4-[2-(2,3,5-trimethylphenoxy)ethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylate |
| SMILES | Cc1cc(C)c(C)c(OCCc2ccc(C3=C(C(=O)OCc4ccccc4)C4CN(C(=O)OC(C)(C)C)CC(C3)N4C(=O)OC(C)(C)C(Cl)(Cl)Cl)cc2)c1 |
| InChI | InChI=1S/C42H49Cl3N2O7/c1-26-20-27(2)28(3)35(21-26)51-19-18-29-14-16-31(17-15-29)33-22-32-23-46(38(49)53-40(4,5)6)24-34(47(32)39(50)54-41(7,8)42(43,44)45)36(33)37(48)52-25-30-12-10-9-11-13-30/h9-17,20-21,32,34H,18-19,22-25H2,1-8H3 |
| InChIKey | RQYWWCYAGSYWOM-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.22 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|