C34H38N2O7Si — CID 91508116
(1R,5S)-7-[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylic acid (PubChem CID 91508116) has the molecular formula C34H38N2O7Si and a molecular weight of 614.77 g/mol. Its IUPAC name is (1R,5S)-7-[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylic acid.
| Compound Name | (1R,5S)-7-[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylic acid |
|---|---|
| PubChem CID | 91508116 |
| Molecular Formula | C34H38N2O7Si |
| Molecular Weight | 614.77 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | (1R,5S)-7-[4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-3,6,9-tricarboxylic acid |
| SMILES | CC(C)(C)[Si](OCCc1ccc(C2=C(C(=O)O)[C@H]3CN(C(=O)O)C[C@@H](C2)N3C(=O)O)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38N2O7Si/c1-34(2,3)44(26-10-6-4-7-11-26,27-12-8-5-9-13-27)43-19-18-23-14-16-24(17-15-23)28-20-25-21-35(32(39)40)22-29(30(28)31(37)38)36(25)33(41)42/h4-17,25,29H,18-22H2,1-3H3,(H,37,38)(H,39,40)(H,41,42)/t25-,29-/m1/s1 |
| InChIKey | RCHIOSBUDAGRBN-VAVYLYDRSA-N |
| XLogP | 4.76 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|