C17H9ClFN3OS — CID 86640256
4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-1-benzothiophen-7-yl]pyridin-3-ol (PubChem CID 86640256) has the molecular formula C17H9ClFN3OS and a molecular weight of 357.80 g/mol. Its IUPAC name is 4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-1-benzothiophen-7-yl]pyridin-3-ol.
| Compound Name | 4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-1-benzothiophen-7-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 86640256 |
| Molecular Formula | C17H9ClFN3OS |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-1-benzothiophen-7-yl]pyridin-3-ol |
| SMILES | Oc1cnccc1-c1cccc2cc(-c3nc(Cl)ncc3F)sc12 |
| InChI | InChI=1S/C17H9ClFN3OS/c18-17-21-7-12(19)15(22-17)14-6-9-2-1-3-11(16(9)24-14)10-4-5-20-8-13(10)23/h1-8,23H |
| InChIKey | IJZNIWPHSCQVJU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |