C22H18ClFN6OS — CID 24938008
1-[2-[[4-[7-(2-chloro-4-pyridinyl)-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one (PubChem CID 24938008) has the molecular formula C22H18ClFN6OS and a molecular weight of 468.95 g/mol. Its IUPAC name is 1-[2-[[4-[7-(2-chloro-4-pyridinyl)-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[[4-[7-(2-chloro-4-pyridinyl)-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 24938008 |
| Molecular Formula | C22H18ClFN6OS |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-[2-[[4-[7-(2-chloro-4-pyridinyl)-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNc1ncc(F)c(-c2cc3cccc(-c4ccnc(Cl)c4)c3s2)n1 |
| InChI | InChI=1S/C22H18ClFN6OS/c23-18-11-13(4-5-25-18)15-3-1-2-14-10-17(32-20(14)15)19-16(24)12-28-21(29-19)26-6-8-30-9-7-27-22(30)31/h1-5,10-12H,6-9H2,(H,27,31)(H,26,28,29) |
| InChIKey | IGOYEBNSIXBBAD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|