C24H21F2N9OS — CID 91275838
1-[2-[[4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one (PubChem CID 91275838) has the molecular formula C24H21F2N9OS and a molecular weight of 521.56 g/mol. Its IUPAC name is 1-[2-[[4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[[4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 91275838 |
| Molecular Formula | C24H21F2N9OS |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 1-[2-[[4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoropyrimidin-2-yl]amino]ethyl]imidazolidin-2-one |
| SMILES | CC(N=[N+]=[N-])c1cnc(F)cc1-c1cccc2cc(-c3nc(NCCN4CCNC4=O)ncc3F)sc12 |
| InChI | InChI=1S/C24H21F2N9OS/c1-13(33-34-27)17-11-30-20(26)10-16(17)15-4-2-3-14-9-19(37-22(14)15)21-18(25)12-31-23(32-21)28-5-7-35-8-6-29-24(35)36/h2-4,9-13H,5-8H2,1H3,(H,29,36)(H,28,31,32) |
| InChIKey | XLJGXCDQIQPGLY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|