C23H18F2N10S — CID 86641881
4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoro-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine (PubChem CID 86641881) has the molecular formula C23H18F2N10S and a molecular weight of 504.53 g/mol. Its IUPAC name is 4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoro-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoro-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86641881 |
| Molecular Formula | C23H18F2N10S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-[7-[5-(1-azidoethyl)-2-fluoro-4-pyridinyl]-1-benzothiophen-2-yl]-5-fluoro-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine |
| SMILES | CC(N=[N+]=[N-])c1cnc(F)cc1-c1cccc2cc(-c3nc(NCCn4ccnn4)ncc3F)sc12 |
| InChI | InChI=1S/C23H18F2N10S/c1-13(32-33-26)17-11-28-20(25)10-16(17)15-4-2-3-14-9-19(36-22(14)15)21-18(24)12-29-23(31-21)27-5-7-35-8-6-30-34-35/h2-4,6,8-13H,5,7H2,1H3,(H,27,29,31) |
| InChIKey | IQSDOUQKHSPIBA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|