C24H22F2N8OS — CID 59332508
5-fluoro-4-[7-[2-fluoro-5-[2-(methylamino)ethoxy]-4-pyridinyl]-1-benzothiophen-2-yl]-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine (PubChem CID 59332508) has the molecular formula C24H22F2N8OS and a molecular weight of 508.56 g/mol. Its IUPAC name is 5-fluoro-4-[7-[2-fluoro-5-[2-(methylamino)ethoxy]-4-pyridinyl]-1-benzothiophen-2-yl]-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-[7-[2-fluoro-5-[2-(methylamino)ethoxy]-4-pyridinyl]-1-benzothiophen-2-yl]-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59332508 |
| Molecular Formula | C24H22F2N8OS |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 5-fluoro-4-[7-[2-fluoro-5-[2-(methylamino)ethoxy]-4-pyridinyl]-1-benzothiophen-2-yl]-N-[2-(triazol-1-yl)ethyl]pyrimidin-2-amine |
| SMILES | CNCCOc1cnc(F)cc1-c1cccc2cc(-c3nc(NCCn4ccnn4)ncc3F)sc12 |
| InChI | InChI=1S/C24H22F2N8OS/c1-27-7-10-35-19-14-29-21(26)12-17(19)16-4-2-3-15-11-20(36-23(15)16)22-18(25)13-30-24(32-22)28-5-8-34-9-6-31-33-34/h2-4,6,9,11-14,27H,5,7-8,10H2,1H3,(H,28,30,32) |
| InChIKey | HDZFJZSEKWAOML-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|